26893-73-2 Usage
Uses
Used in Organic Synthesis:
6-METHOXYPYRIDINE-2-CARBOXYLIC ACID is used as a key intermediate for the synthesis of various organic compounds. Its unique structure allows for a wide range of chemical reactions, making it a valuable building block in the development of new molecules with diverse applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 6-METHOXYPYRIDINE-2-CARBOXYLIC ACID is used as a starting material for the development of new drugs. Its chemical properties enable the creation of novel drug candidates with potential therapeutic benefits in various medical fields.
Used in Agrochemicals:
6-METHOXYPYRIDINE-2-CARBOXYLIC ACID is also utilized in the agrochemical industry as a precursor for the synthesis of various pesticides and other agricultural chemicals. Its unique structure allows for the development of innovative products with improved efficacy and reduced environmental impact.
Used in Dyestuffs:
In the dyestuffs industry, 6-METHOXYPYRIDINE-2-CARBOXYLIC ACID is employed as a raw material for the production of various dyes and pigments. Its chemical properties contribute to the development of new colorants with enhanced performance characteristics, such as improved color strength, lightfastness, and resistance to fading.
Check Digit Verification of cas no
The CAS Registry Mumber 26893-73-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,8,9 and 3 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 26893-73:
(7*2)+(6*6)+(5*8)+(4*9)+(3*3)+(2*7)+(1*3)=152
152 % 10 = 2
So 26893-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO3/c1-11-7-5-3-4-6(9-7)8(10)12-2/h3-5H,1-2H3
