27058-54-4 Usage
Uses
Used in Pharmaceutical Industry:
5-Pyrimidinecarbonitrile, 1,4-dihydro-2-methyl-4-oxo(8CI,9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for its potential to contribute to the development of new drugs. Its unique structure and reactivity allow for the creation of diverse chemical compounds with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Pyrimidinecarbonitrile, 1,4-dihydro-2-methyl-4-oxo(8CI,9CI) is utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its properties enable the development of effective compounds for crop protection and enhancement of agricultural productivity.
Used in Medicinal Chemistry Research:
5-Pyrimidinecarbonitrile, 1,4-dihydro-2-methyl-4-oxo(8CI,9CI) is employed as a research compound in medicinal chemistry, where it aids scientists in understanding the structure-activity relationships of various drug candidates. Its reactivity and structural features make it a valuable tool for exploring new chemical spaces and identifying potential drug targets.
Used in Drug Discovery:
As a component in drug discovery processes, 5-Pyrimidinecarbonitrile, 1,4-dihydro-2-methyl-4-oxo(8CI,9CI) is leveraged for its potential to form the basis of new drug candidates. Its unique structural elements can be modified to optimize pharmacological properties, such as potency, selectivity, and bioavailability, leading to the development of innovative therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 27058-54-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,0,5 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 27058-54:
(7*2)+(6*7)+(5*0)+(4*5)+(3*8)+(2*5)+(1*4)=114
114 % 10 = 4
So 27058-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3O/c1-4-8-3-5(2-7)6(10)9-4/h3H,1H3,(H,8,9,10)
