27149-59-3 Usage
Description
Methyl 2-cyano-3-(4-methoxyphenyl)-2-butenoate is a chemical compound with the formula C12H11NO3. It is an ester that contains a cyano group and a methoxyphenyl group attached to a butenoate backbone. This versatile compound is known for its unique chemical structure and reactivity, making it a promising candidate for various applications in the field of chemistry and biotechnology.
Uses
Used in Organic Synthesis:
Methyl 2-cyano-3-(4-methoxyphenyl)-2-butenoate is used as a building block in organic synthesis for the production of various pharmaceuticals, agrochemicals, and other fine chemicals. Its unique chemical structure and reactivity make it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Development:
Methyl 2-cyano-3-(4-methoxyphenyl)-2-butenoate is used as a key intermediate in the development of new drugs. Its presence in the molecular structure can contribute to the desired pharmacological properties, such as potency, selectivity, and bioavailability, making it an essential component in the design and synthesis of novel therapeutic agents.
Used in Agrochemical Production:
Methyl 2-cyano-3-(4-methoxyphenyl)-2-butenoate is also utilized in the production of agrochemicals, such as pesticides and herbicides. Its unique chemical properties can be harnessed to create effective and environmentally friendly solutions for agricultural applications.
Used in Material Science:
Due to its potential use in the development of new materials, methyl 2-cyano-3-(4-methoxyphenyl)-2-butenoate is employed in material science research. Its unique structure and reactivity can be leveraged to create innovative materials with improved properties, such as enhanced stability, durability, or specific functional characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 27149-59-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,1,4 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 27149-59:
(7*2)+(6*7)+(5*1)+(4*4)+(3*9)+(2*5)+(1*9)=123
123 % 10 = 3
So 27149-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO3/c1-9(12(8-14)13(15)17-3)10-4-6-11(16-2)7-5-10/h4-7H,1-3H3/b12-9+
27149-59-3Relevant articles and documents
PHOTOSTABLE COMPOSITIONS COMPRISING PARA-ALKOXYL PHENYL SUBSTITUTED PROPENOIC ACID (APP) DERIVATIVES
-
Page/Page column 0058; 0059, (2016/09/26)
The present disclosure relates, according to some embodiments, to photostable UV absorbing compositions comprising para-alkoxyl phenyl substituted propenoic acid (APP) derivatives. Furthermore, the present disclosure relates to methods of prolonging the UV absorption capabilities of a composition using photostable UV absorbing compositions comprising APP derivatives.
