2723-37-7 Usage
Type of compound
chemical compound and salt
Structure
contains a dimethylaminoethyl group attached to a diphenylacetate molecule
Formation
formed by the reaction of diphenylacetate with hydrochloric acid
Use in pharmaceutical research
potential drug candidate due to its ability to interact with certain biological receptors and its potential therapeutic effects
Potential applications
being investigated for its use in the treatment of certain central nervous system disorders
Additional research needed
further research is needed to fully understand the pharmacological properties and potential applications of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 2723-37-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,7,2 and 3 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2723-37:
(6*2)+(5*7)+(4*2)+(3*3)+(2*3)+(1*7)=77
77 % 10 = 7
So 2723-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H21NO2/c1-19(2)13-14-21-18(20)17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3
