2729-37-5 Usage
Uses
Used in Agricultural Chemicals Industry:
2,5-dichloro-4-fluoroaniline is used as an intermediate for the production of various agricultural chemicals. It plays a crucial role in the synthesis of active ingredients for pesticides and herbicides, contributing to the development of effective crop protection solutions.
Used in Dyes Industry:
2,5-dichloro-4-fluoroaniline is used as a building block in the synthesis of dyes. Its unique molecular structure allows for the creation of dyes with specific color properties, making it valuable in the production of textiles, paints, and other colorant applications.
Used in Pharmaceuticals Industry:
2,5-dichloro-4-fluoroaniline is used as an intermediate in the synthesis of pharmaceuticals. Its presence in the molecular structure of certain drugs aids in the development of medications with specific therapeutic properties, contributing to advancements in healthcare and medicine.
It is important to handle 2,5-dichloro-4-fluoroaniline with care, as it may be harmful if inhaled, ingested, or comes into contact with skin. Additionally, proper management is required to prevent potential environmental harm.
Check Digit Verification of cas no
The CAS Registry Mumber 2729-37-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,7,2 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2729-37:
(6*2)+(5*7)+(4*2)+(3*9)+(2*3)+(1*7)=95
95 % 10 = 5
So 2729-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4Cl2FN/c7-3-2-6(10)4(8)1-5(3)9/h1-2H,10H2
2729-37-5Relevant academic research and scientific papers
SMALL MOLECULE INHIBITORS OF GALECTIN-3
-
, (2019/04/26)
The present disclosure relates to compounds of formula I, which inhibit Gal-3, and include pharmaceutically acceptable salts, compositions comprising such compounds, and methods using and making such compounds and compositions.