2736-18-7 Usage
General Description
2-Sodiumhydroxy-4,6-dichloro-1,3,5-triazine is a chemical compound that is mainly used as a disinfectant and sanitizer. It is an effective and stable source of chlorine for water treatment, as it can release chlorine slowly and continuously, providing long-lasting protection against microbial contamination in water systems. Additionally, it is also used as a biocide in industrial applications and as a preservative in various products. Due to its strong oxidizing properties, it is important to handle this chemical with care and follow safety protocols to prevent any potential hazards to health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 2736-18-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,7,3 and 6 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 2736-18:
(6*2)+(5*7)+(4*3)+(3*6)+(2*1)+(1*8)=87
87 % 10 = 7
So 2736-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C3HCl2N3O.Na/c4-1-6-2(5)8-3(9)7-1;/h(H,6,7,8,9);/q;+1
2736-18-7Relevant articles and documents
COLORANT, INK, INK-JET INK, METHOD OF INK-JET RECORDING, COLOR TONER, AND COLOR FILTER
-
Page/Page column 44; 45, (2010/11/28)
[Problem] To provide a coloring matter which has a good hue, and is capable of forming an image high in fastness property under various use conditions and environmental conditions, and particularly suitable for an ink. [Solving Means] A coloring matter represented by the following formula (I): wherein in the formula, G represents a heterocyclic group, and n represents an integer of 1 to 3; when n is 1, R, X, Y, Z, Q, and G each represents a monovalent group; when n is 2, R, X, Y, Z, Q, and G each represents a monovalent or divalent substituent, provided that at least one represents a divalent substituent; and when n is 3, R, X, Y, Z, Q, and G each represents a monovalent, divalent or trivalent substituent, provided that at least two each represents a divalent substituent, or at least one represents a trivalent substituent.