2736-18-7 Usage
Uses
Used in Water Treatment Industry:
2-Sodiumhydroxy-4,6-dichloro-1,3,5-triazine is used as a disinfectant and sanitizer for its ability to release chlorine slowly and continuously, ensuring long-term protection of water systems against microbial contamination.
Used in Industrial Applications:
In various industrial settings, 2-Sodiumhydroxy-4,6-dichloro-1,3,5-triazine serves as a biocide, leveraging its strong oxidizing properties to control and prevent the growth of microorganisms that could compromise the integrity and safety of industrial processes and products.
Used as a Preservative in Various Products:
2-Sodiumhydroxy-4,6-dichloro-1,3,5-triazine is utilized as a preservative in a range of products to prevent spoilage and extend shelf life by inhibiting the growth of microorganisms.
It is crucial to handle 2-Sodiumhydroxy-4,6-dichloro-1,3,5-triazine with care, adhering to safety protocols to mitigate potential health and environmental hazards due to its potent oxidizing nature.
Check Digit Verification of cas no
The CAS Registry Mumber 2736-18-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,7,3 and 6 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 2736-18:
(6*2)+(5*7)+(4*3)+(3*6)+(2*1)+(1*8)=87
87 % 10 = 7
So 2736-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C3HCl2N3O.Na/c4-1-6-2(5)8-3(9)7-1;/h(H,6,7,8,9);/q;+1
2736-18-7Relevant academic research and scientific papers
COLORANT, INK, INK-JET INK, METHOD OF INK-JET RECORDING, COLOR TONER, AND COLOR FILTER
-
Page/Page column 44; 45, (2010/11/28)
[Problem] To provide a coloring matter which has a good hue, and is capable of forming an image high in fastness property under various use conditions and environmental conditions, and particularly suitable for an ink. [Solving Means] A coloring matter represented by the following formula (I): wherein in the formula, G represents a heterocyclic group, and n represents an integer of 1 to 3; when n is 1, R, X, Y, Z, Q, and G each represents a monovalent group; when n is 2, R, X, Y, Z, Q, and G each represents a monovalent or divalent substituent, provided that at least one represents a divalent substituent; and when n is 3, R, X, Y, Z, Q, and G each represents a monovalent, divalent or trivalent substituent, provided that at least two each represents a divalent substituent, or at least one represents a trivalent substituent.
