27693-35-2 Usage
Chemical structure
A pyridine derivative containing two chlorine atoms and a benzoyl group.
Uses
Commonly used in the pharmaceutical industry as a building block for the synthesis of various biologically active compounds, studied for its potential as a pesticide, and as a component in materials science.
Chemical properties
The presence of chlorine atoms and the benzoyl group gives 2-(2,4-Dichlorobenzoyl)pyridine specific chemical properties.
Physical properties
The presence of chlorine atoms and the benzoyl group gives 2-(2,4-Dichlorobenzoyl)pyridine specific physical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 27693-35-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,6,9 and 3 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 27693-35:
(7*2)+(6*7)+(5*6)+(4*9)+(3*3)+(2*3)+(1*5)=142
142 % 10 = 2
So 27693-35-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H7Cl2NO/c13-8-4-5-9(10(14)7-8)12(16)11-3-1-2-6-15-11/h1-7H
27693-35-2Relevant academic research and scientific papers
Ortho-halogenated phenylpyridine ketone compound and preparation method thereof
-
Paragraph 0130-0133, (2019/12/25)
The invention relates to an ortho-halogenated phenylpyridine ketone compound and a preparation method thereof. According to the invention, dibromohydantoin or dichlorohydantoin is taken as a halogenating reagent, and the ortho-halogenation of a diarylketo
