27807-62-1 Usage
Uses
Used in Organic Synthesis:
BIS(2-CHOROETHYL)-2-METHOXYETHYLAMINE is used as a reactive intermediate for various organic synthesis processes due to its unique structure and reactivity. Its presence of both amine and ether functionalities allows it to participate in a wide range of chemical reactions, making it a valuable component in the synthesis of various organic compounds.
Used in Chemical Research:
In the field of chemical research, BIS(2-CHOROETHYL)-2-METHOXYETHYLAMINE serves as a subject of study for understanding the properties and behavior of organochlorine compounds, as well as exploring its potential applications in the development of new chemical processes and products.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, given its reactivity and structural features, BIS(2-CHOROETHYL)-2-METHOXYETHYLAMINE could potentially be used as a building block or intermediate in the synthesis of pharmaceutical compounds, contributing to the development of new drugs and therapies.
Used in Chemical Manufacturing:
In the chemical manufacturing industry, BIS(2-CHOROETHYL)-2-METHOXYETHYLAMINE may be employed as a component in the production of various chemical products, leveraging its reactivity and functional groups to create a diverse array of end products.
Check Digit Verification of cas no
The CAS Registry Mumber 27807-62-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,8,0 and 7 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 27807-62:
(7*2)+(6*7)+(5*8)+(4*0)+(3*7)+(2*6)+(1*2)=131
131 % 10 = 1
So 27807-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H15Cl2NO.ClH/c1-11-7-6-10(4-2-8)5-3-9;/h2-7H2,1H3;1H