27963-97-9 Usage
Uses
Used in Chemical and Biochemical Research:
2-AMINO-ALPHA-D-RIBOFURANO[1',2':4,5]OXAZOLINE is used as a building block for the synthesis of nucleosides and nucleotides, which are essential components of DNA and RNA. Its presence in these molecules is crucial for their biological functions, including the storage and transmission of genetic information.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-AMINO-ALPHA-D-RIBOFURANO[1',2':4,5]OXAZOLINE is used as a key intermediate in the development of new drugs and therapeutic agents. Its ability to form stable complexes with other molecules makes it a promising candidate for the design of novel pharmaceutical compounds with potential applications in various therapeutic areas.
Used in Biochemical Analysis:
2-AMINO-ALPHA-D-RIBOFURANO[1',2':4,5]OXAZOLINE is employed as a reagent in various biochemical assays and analyses. Its unique chemical properties allow for the detection and quantification of specific biomolecules, contributing to a better understanding of biological processes and the development of diagnostic tools.
Used in Material Science:
In the field of material science, 2-AMINO-ALPHA-D-RIBOFURANO[1',2':4,5]OXAZOLINE is utilized in the synthesis of advanced materials with specific properties. Its ability to form stable complexes with other molecules enables the creation of materials with tailored characteristics, such as improved stability, biocompatibility, or specific binding affinities.
Overall, 2-AMINO-ALPHA-D-RIBOFURANO[1',2':4,5]OXAZOLINE's diverse applications across various industries highlight its significance as a versatile and valuable chemical compound in modern science and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 27963-97-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,9,6 and 3 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 27963-97:
(7*2)+(6*7)+(5*9)+(4*6)+(3*3)+(2*9)+(1*7)=159
159 % 10 = 9
So 27963-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O3.H2O/c9-5(6(10)11)1-4-2-7-3-8-4;/h2-3,5,9H,1H2,(H,7,8)(H,10,11);1H2/t5-;/m0./s1
27963-97-9Relevant academic research and scientific papers
Phosphate-mediated interconversion of Ribo- and Arabino-configured prebiotic nucleotide intermediates
Powner, Matthew W.,Sutherland, John D.
supporting information; experimental part, p. 4641 - 4643 (2010/09/07)
(Represented Chemical Equation) Flipping stereochemistry: Inorganic phosphate catalyzes the interconversion of ribose and arabinose aminooxazolines, suggesting that the prebiotic synthesis of enantiopure pyrimidine ribonucleotides might have involved a single stereoinversion at Cl′ and a double stereoinversion at C2′.
