28092-54-8 Usage
Description
(3aS-cis)-1,3-dibenzyltetrahydro-4-(3-methoxypropylidene)-1H-thieno[3,4-d]imidazol-2(3H)-one is a synthetic organic compound characterized by its complex molecular structure. It is a tetrahydrothienoimidazole derivative, featuring dibenzyl and methoxypropylidene groups. (3aS-cis)-1,3-dibenzyltetrahydro-4-(3-methoxypropylidene)-1H-thieno[3,4-d]imidazol-2(3H)-one is likely to possess unique chemical and pharmacological properties due to its specific structural features, which may make it a promising candidate for pharmaceutical research and development.
Uses
Used in Pharmaceutical Research and Development:
(3aS-cis)-1,3-dibenzyltetrahydro-4-(3-methoxypropylidene)-1H-thieno[3,4-d]imidazol-2(3H)-one is used as a potential candidate for pharmaceutical research and development due to its unique chemical and pharmacological properties. Its specific structure may offer novel therapeutic applications, although further studies are required to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 28092-54-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,0,9 and 2 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 28092-54:
(7*2)+(6*8)+(5*0)+(4*9)+(3*2)+(2*5)+(1*4)=118
118 % 10 = 8
So 28092-54-8 is a valid CAS Registry Number.
InChI:InChI=1/C23H26N2O2S/c1-27-14-8-13-21-22-20(17-28-21)24(15-18-9-4-2-5-10-18)23(26)25(22)16-19-11-6-3-7-12-19/h2-7,9-13,20,22H,8,14-17H2,1H3/b21-13+/t20-,22-/m0/s1