28224-69-3 Usage
Uses
Used in Pharmaceutical and Biochemical Research:
2-Amino-5-ethyl-6-methylpyrimidin-4-ol is utilized as a research compound for its potential applications in drug development. Its unique structure allows for the exploration of its interactions with biological systems and the development of new therapeutic agents.
Used in Antibacterial Applications:
2-Amino-5-ethyl-6-methylpyrimidin-4-ol is studied for its potential antibacterial properties, which could contribute to the development of new antimicrobial agents to combat resistant bacterial strains.
Used in Antiviral Applications:
2-AMINO-5-ETHYL-6-METHYLPYRIMIDIN-4-OL is also investigated for its antiviral potential, which may lead to the creation of novel antiviral drugs to treat various viral infections.
Used in Organic Synthesis:
2-Amino-5-ethyl-6-methylpyrimidin-4-ol serves as a building block in the synthesis of various organic compounds, contributing to the advancement of organic chemistry and the development of new chemical entities.
Used in Industrial and Scientific Applications:
As a component in the production of novel materials, 2-Amino-5-ethyl-6-methylpyrimidin-4-ol plays a role in the creation of new materials for a wide range of industrial and scientific uses, enhancing the capabilities and performance of various products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 28224-69-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,2,2 and 4 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28224-69:
(7*2)+(6*8)+(5*2)+(4*2)+(3*4)+(2*6)+(1*9)=113
113 % 10 = 3
So 28224-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O/c1-3-5-4(2)9-7(8)10-6(5)11/h3H2,1-2H3,(H3,8,9,10,11)
