282540-26-5 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 6-FLUORO-2-METHYLQUINOLINE-3-CARBOXYLATE is used as a building block in organic synthesis for the production of various pharmaceuticals. Its unique structure and potential biological activity make it valuable in drug discovery and development, contributing to the creation of novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, ETHYL 6-FLUORO-2-METHYLQUINOLINE-3-CARBOXYLATE serves as a key component in the synthesis of various agrochemicals. Its reactivity and functional groups play a crucial role in the development of effective compounds for agricultural applications, such as pesticides and herbicides, enhancing crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 282540-26-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,2,5,4 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 282540-26:
(8*2)+(7*8)+(6*2)+(5*5)+(4*4)+(3*0)+(2*2)+(1*6)=135
135 % 10 = 5
So 282540-26-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12FNO2/c1-3-17-13(16)11-7-9-6-10(14)4-5-12(9)15-8(11)2/h4-7H,3H2,1-2H3
282540-26-5Relevant academic research and scientific papers
Zhu, Zhengbo,Seidel, Daniel
, p. 2841 - 2844 (2017)
Amines such as 1,2,3,4-tetrahydroisoquinoline undergo redox-neutral annulations with 2-alkylquinoline-3-carbaldehydes as well as the corresponding 4-alkyl isomers and pyridine analogues. These processes involve dual C-H bond functionalization. Acetic acid
