28343-61-5 Usage
Description
CHLOROTHALONIL-4-HYDROXY, also known as Hydroxychlorothalonil, is a metabolite of Chlorothalonil (C411250). It belongs to the class of trichlorophenols, characterized by isophthalonitrile substitution at positions 2, 4, and 5 with chloro groups and a hydroxy group at position 6. As the major metabolite of chlorothalonil, CHLOROTHALONIL-4-HYDROXY plays a significant role in various applications across different industries.
Uses
Used in Chemical Industry:
CHLOROTHALONIL-4-HYDROXY is used as an intermediate for the synthesis of various chemical compounds. Its unique structure with chloro and hydroxy groups makes it a valuable building block for the development of new molecules with potential applications in various fields.
Used in Pharmaceutical Industry:
CHLOROTHALONIL-4-HYDROXY is used as a starting material for the development of new pharmaceutical compounds. Its structural features can be exploited to design drugs with specific therapeutic properties, targeting various diseases and medical conditions.
Used in Agrochemical Industry:
CHLOROTHALONIL-4-HYDROXY is used as an active ingredient in the formulation of pesticides and fungicides. Its chlorinated structure provides effective control against a wide range of pests and diseases in agriculture, contributing to increased crop yield and protection.
Used in Environmental Applications:
CHLOROTHALONIL-4-HYDROXY is used in the development of environmental remediation technologies. Its ability to form complexes with various contaminants can be utilized for the removal of pollutants from soil, water, and air, thus contributing to a cleaner and healthier environment.
Used in Material Science:
CHLOROTHALONIL-4-HYDROXY is used as a component in the development of advanced materials with specific properties. Its incorporation into polymers, for instance, can enhance their stability, durability, and resistance to environmental factors, making them suitable for various applications in the material science field.
Check Digit Verification of cas no
The CAS Registry Mumber 28343-61-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,3,4 and 3 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 28343-61:
(7*2)+(6*8)+(5*3)+(4*4)+(3*3)+(2*6)+(1*1)=115
115 % 10 = 5
So 28343-61-5 is a valid CAS Registry Number.
InChI:InChI=1/C8HCl3N2O/c9-5-3(1-12)6(10)7(11)8(14)4(5)2-13/h14H