28466-69-5 Usage
General Description
1-benzyl-3,5-dimethyl-pyrazol-4-amine is a chemical compound with the molecular formula C14H17N3. It is a pyrazole derivative with a benzyl group and two methyl groups attached to the pyrazole ring. 1-benzyl-3,5-dimethyl-pyrazol-4-amine has potential applications in pharmaceutical and medicinal chemistry as it exhibits biological activities such as antimicrobial and antiproliferative properties. Additionally, the benzyl group in the molecule provides a site for further chemical modification, making it a valuable building block for the synthesis of novel drugs and pharmaceuticals. The chemical structure of 1-benzyl-3,5-dimethyl-pyrazol-4-amine makes it an interesting target for research and development in the field of drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 28466-69-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,4,6 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 28466-69:
(7*2)+(6*8)+(5*4)+(4*6)+(3*6)+(2*6)+(1*9)=145
145 % 10 = 5
So 28466-69-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3/c1-9-12(13)10(2)15(14-9)8-11-6-4-3-5-7-11/h3-7H,8,13H2,1-2H3
28466-69-5Relevant articles and documents
ANTICANCER COMPOUNDS
-
Paragraph 0100, (2018/05/03)
The invention provides compounds having the general formula I: and salts thereof, wherein the variables RA, RB, RC, L1, L2, L3, A, B, C, X, Y, Z, E, m, n, and p have the meaning as describe