2852-24-6 Usage
Uses
Used in Pharmaceutical Industry:
2-chloro-N-(2-diethylaminoethyl)benzamide is used as an active pharmaceutical ingredient for the development of new drugs. Its unique structure and functional groups contribute to its potential therapeutic properties, which can be harnessed to address specific medical needs.
Used in Research and Development:
In the field of research and development, 2-chloro-N-(2-diethylaminoethyl)benzamide serves as a key compound for studying the effects of various chemical modifications on the properties and activities of related molecules. This aids in the advancement of knowledge in organic chemistry and the discovery of novel chemical entities with potential applications.
Used in Organic Synthesis:
2-chloro-N-(2-diethylaminoethyl)benzamide is employed as a building block or intermediate in the synthesis of more complex organic molecules. Its versatile structure allows for further functionalization and modification, making it a valuable component in the creation of new compounds with specific properties and uses.
Used in Biochemical Research:
In biochemical research, 2-chloro-N-(2-diethylaminoethyl)benzamide is utilized to investigate its interactions with biological systems, such as enzymes, receptors, or other biomolecules. This helps in understanding the molecular mechanisms underlying its potential biological activities and contributes to the development of targeted therapies and diagnostic tools.
Check Digit Verification of cas no
The CAS Registry Mumber 2852-24-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,5 and 2 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2852-24:
(6*2)+(5*8)+(4*5)+(3*2)+(2*2)+(1*4)=86
86 % 10 = 6
So 2852-24-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H19ClN2O/c1-3-16(4-2)10-9-15-13(17)11-7-5-6-8-12(11)14/h5-8H,3-4,9-10H2,1-2H3,(H,15,17)
