2860-55-1 Usage
General Description
2-Hydroxy-6-Methylpyridine-3,4-dicarboxylic acid is a chemical compound that belongs to the pyridine carboxylic acid family. It is also known as 6-hydroxy-3-methylpyridine-4-carboxylic acid. It is a white crystalline solid that is sparingly soluble in water. This chemical is used primarily in the production of pharmaceuticals and dyes. It has potential applications in the synthesis of new drugs and in the development of pharmaceutical intermediates. Additionally, its unique molecular structure gives it potential use as a chelating agent in metal ion coordination chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 2860-55-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,8,6 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2860-55:
(6*2)+(5*8)+(4*6)+(3*0)+(2*5)+(1*5)=91
91 % 10 = 1
So 2860-55-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H7NO5/c1-3-2-4(7(11)12)5(8(13)14)6(10)9-3/h2H,1H3,(H,9,10)(H,11,12)(H,13,14)