28615-70-5 Usage
Uses
Used in Pharmaceutical Research and Development:
4-BROMOQINOLINE-2-CARBOXALDEHYDE is used as a key intermediate in the synthesis of various pharmaceutical products. Its ability to form heterocyclic compounds makes it instrumental in creating complex molecular structures that can target specific biological pathways, potentially leading to the development of novel therapeutic agents.
Used in Agrochemical Production:
In the agrochemical industry, 4-BROMOQINOLINE-2-CARBOXALDEHYDE is utilized as an intermediate for the production of various agrochemical products. Its chemical properties allow for the creation of compounds that can effectively address challenges in agriculture, such as pest control and crop protection.
Used in Organic Synthesis:
4-BROMOQINOLINE-2-CARBOXALDEHYDE is employed as a reactant in organic synthesis, where it contributes to the formation of a wide range of heterocyclic compounds. These compounds have diverse applications across various industries, including pharmaceuticals, materials science, and chemical research.
Used in Drug Development:
4-BROMOQINOLINE-2-CARBOXALDEHYDE is used as a starting material in the development of new drugs. Its potential to form heterocyclic compounds with unique biological activities makes it a valuable asset in the search for innovative therapeutic solutions.
Used as a Fluorescent Probe:
In the field of biological and environmental monitoring, 4-BROMOQINOLINE-2-CARBOXALDEHYDE serves as a fluorescent probe. Its optical properties allow for the detection and analysis of various biological and environmental samples, providing valuable insights into the behavior of different substances and their interactions with their surroundings.
Check Digit Verification of cas no
The CAS Registry Mumber 28615-70-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,6,1 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 28615-70:
(7*2)+(6*8)+(5*6)+(4*1)+(3*5)+(2*7)+(1*0)=125
125 % 10 = 5
So 28615-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H6BrNO/c11-9-5-7(6-13)12-10-4-2-1-3-8(9)10/h1-6H
28615-70-5Relevant academic research and scientific papers
CARBOXY SUBSTITUTED (HETERO) AROMATIC RING DERIVATIVES AND PREPARATION METHOD AND USES THEREOF
-
Page/Page column 130; 131, (2017/03/21)
Carboxy-substituted (hetero)aryl derivatives, pharmaceutical compositions comprising these compounds, and methods of preparing such compounds and compositions are provided. The compounds or compositions are useful in inhibiting xanthine oxidase and urate anion transporter 1, and also can be used in the treatment or prevention of diseases associated with high blood uric acid level in mammals, especially humans.
