28900-27-8 Usage
Description
(+)-2-Methoxy-3,5-dimethyl-6-[4-[7-(4-nitrophenyl)-2,4,6-trimethyl-2,4,6-heptatrienylidene]tetrahydrofuran-2-yl]-4H-pyran-4-one is a complex organic compound with a unique molecular structure. It is characterized by its 4H-pyran-4-one core, which is substituted with various functional groups, including methoxy, dimethyl, and a heptatrienylidene group. (+)-2-Methoxy-3,5-dimethyl-6-[4-[7-(4-nitrophenyl)-2,4,6-trimethyl-2,4,6-heptatrienylidene]tetrahydrofuran-2-yl]-4H-pyran-4-one is likely to have specific applications in various fields due to its distinct chemical properties.
Uses
1. Used in Pharmaceutical Applications:
(+)-2-Methoxy-3,5-dimethyl-6-[4-[7-(4-nitrophenyl)-2,4,6-trimethyl-2,4,6-heptatrienylidene]tetrahydrofuran-2-yl]-4H-pyran-4-one is used as a pharmaceutical agent for its potential therapeutic effects. (+)-2-Methoxy-3,5-dimethyl-6-[4-[7-(4-nitrophenyl)-2,4,6-trimethyl-2,4,6-heptatrienylidene]tetrahydrofuran-2-yl]-4H-pyran-4-one's unique structure may allow it to interact with specific biological targets, making it a candidate for the development of new drugs.
2. Used in Chemical Research:
In the field of chemical research, (+)-2-Methoxy-3,5-dimethyl-6-[4-[7-(4-nitrophenyl)-2,4,6-trimethyl-2,4,6-heptatrienylidene]tetrahydrofuran-2-yl]-4H-pyran-4-one can be used as a starting material or a synthetic intermediate for the development of new compounds with various applications. Its complex structure may provide insights into new reaction pathways and mechanisms.
3. Used in Material Science:
(+)-2-Methoxy-3,5-dimethyl-6-[4-[7-(4-nitrophenyl)-2,4,6-trimethyl-2,4,6-heptatrienylidene]tetrahydrofuran-2-yl]-4H-pyran-4-one may also find applications in material science, where its unique chemical properties could be exploited to develop new materials with specific characteristics. For example, it could be used in the development of advanced polymers, coatings, or other materials with tailored properties.
4. Used in Analytical Chemistry:
(+)-2-Methoxy-3,5-dimethyl-6-[4-[7-(4-nitrophenyl)-2,4,6-trimethyl-2,4,6-heptatrienylidene]tetrahydrofuran-2-yl]-4H-pyran-4-one can be used as a reference compound or a standard in analytical chemistry. Its distinct structure and properties may make it useful for calibrating instruments, validating analytical methods, or as a benchmark in comparative studies.
Check Digit Verification of cas no
The CAS Registry Mumber 28900-27-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,9,0 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 28900-27:
(7*2)+(6*8)+(5*9)+(4*0)+(3*0)+(2*2)+(1*7)=118
118 % 10 = 8
So 28900-27-8 is a valid CAS Registry Number.
InChI:InChI=1/C28H31NO6/c1-17(11-18(2)13-22-7-9-24(10-8-22)29(31)32)12-19(3)14-23-15-25(34-16-23)27-20(4)26(30)21(5)28(33-6)35-27/h7-14,25H,15-16H2,1-6H3/b17-11+,18-13+,19-12+,23-14+
28900-27-8Relevant articles and documents
The biomimetic synthesis of SNF4435C and SNF4435D, and the total synthesis of the polyene metabolites aureothin, N-acetyl-aureothamine and spectinabilin
Jacobsen, Mikkel F.,Moses, John E.,Adlington, Robert M.,Baldwin, Jack E.
, p. 1675 - 1689 (2007/10/03)
Full details of the biomimetic conversion of polyene metabolite spectinabilin (5) into the isomeric natural products SNF4435C (1) and SNF4435D (2) by a cascade of E/Z-isomerizations and electrocyclizations are reported. Additionally, short total syntheses