289039-29-8 Usage
Description
2-Chloro-5-iodobenzonitrile is an organic compound characterized by its white to light yellow crystal powder appearance. It is a versatile reagent utilized in the synthesis of various chemical compounds, particularly those with heteroaryl-substituted acetamides.
Uses
Used in Pharmaceutical Industry:
2-Chloro-5-iodobenzonitrile is used as a general reagent for the synthesis of heteroaryl-substituted acetamides, which are known for their potential as Wnt signaling modulators. Wnt signaling plays a crucial role in various biological processes, including cell proliferation, differentiation, and tissue homeostasis. Modulating this signaling pathway can have significant implications in the development of therapeutic strategies for various diseases, particularly those related to cancer and other proliferative disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 289039-29-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,9,0,3 and 9 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 289039-29:
(8*2)+(7*8)+(6*9)+(5*0)+(4*3)+(3*9)+(2*2)+(1*9)=178
178 % 10 = 8
So 289039-29-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClIN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H
