29084-76-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2,4-dichloroanilinium chloride is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows for the development of new drugs with potential therapeutic benefits.
Used in Dye Production:
In the dye industry, 2,4-dichloroanilinium chloride serves as a crucial component in the production of dyes. Its ability to impart color makes it a valuable asset in creating a wide range of dyes for different applications.
Used as a Reagent in Organic Chemistry:
2,4-dichloroanilinium chloride is utilized as a reagent in various organic chemistry reactions. Its reactivity and stability make it a preferred choice for researchers and chemists in conducting experiments and synthesizing new compounds.
Used in Medical Research:
2,4-dichloroanilinium chloride has been studied for its potential use in the treatment of certain medical conditions, such as cancer and bacterial infections. Its unique properties and interactions with biological systems make it a promising candidate for further research and development in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 29084-76-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,0,8 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 29084-76:
(7*2)+(6*9)+(5*0)+(4*8)+(3*4)+(2*7)+(1*6)=132
132 % 10 = 2
So 29084-76-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H5Cl2N.ClH/c7-4-1-2-6(9)5(8)3-4;/h1-3H,9H2;1H
29084-76-2Relevant academic research and scientific papers
Biguanide derivatives, manufacturing method thereof, and disinfectants containing the derivatives
-
, (2008/06/13)
The invention presents a biguanide derivative or its salt expressed by a formula: STR1 (where R1 and R2 are as defined in Specification), or formula: STR2 (where A and R3 is as defined in specification). This biguanide derivative or its salt is preferably used as the effective amount of a disinfectant for humans, animals, medical appliances, etc.
