29646-35-3 Usage
Uses
Used in Laboratory Settings:
5-Chloro-1H-indazole-3-carbonitrile is used as a chemical intermediate for the synthesis of other chemical compounds. Its unique structure, which includes a chlorine atom and a nitrile group, makes it a valuable component in various chemical reactions and processes.
Used in Chemical Synthesis:
In the field of organic chemistry, 5-Chloro-1H-indazole-3-carbonitrile is employed as a key building block in the synthesis of more complex molecules. Its presence in the molecular structure can influence the reactivity and properties of the final product, making it an essential component in the development of new chemical entities.
Used in Research and Development:
5-Chloro-1H-indazole-3-carbonitrile is utilized in research and development settings to explore its potential applications and properties. Scientists and researchers use 5-CHLORO-1H-INDAZOLE-3-CARBONITRILE to investigate its reactivity, stability, and interactions with other molecules, which can lead to the discovery of new chemical reactions and the development of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 29646-35-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,6,4 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 29646-35:
(7*2)+(6*9)+(5*6)+(4*4)+(3*6)+(2*3)+(1*5)=143
143 % 10 = 3
So 29646-35-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H4ClN3/c9-5-1-2-7-6(3-5)8(4-10)12-11-7/h1-3H,(H,11,12)
29646-35-3Relevant academic research and scientific papers
NOVEL INDAZOLE COMPOUNDS AND A PROCESS FOR THE PREPARATION THEREOF
-
Page/Page column 18, (2015/02/25)
The patent discloses novel indazole compounds of general formula1 and analogues thereof, use thereof for the treatment of diabetes, diabetic complications, cardiovascular dysfuntion or related diseases, pharmaceutical compositions comprising them and processes for their preparation.
