303121-10-0 Usage
Uses
Used in Pharmaceutical Industry:
6-Ethoxy-4-hydroxy-quinoline-3-carboxylic acid is used as an intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into the molecular structures of various drugs. Its presence in drug molecules can contribute to the desired pharmacological properties, such as improved solubility, stability, or bioavailability.
Used in Agrochemical Industry:
In the agrochemical industry, 6-Ethoxy-4-hydroxy-quinoline-3-carboxylic acid is used as an intermediate in the development of agrochemicals, such as pesticides or herbicides. Its chemical properties allow it to be a component of active ingredients that can target specific pests or weeds, enhancing the effectiveness of these products.
Used in Drug Development:
6-Ethoxy-4-hydroxy-quinoline-3-carboxylic acid is utilized in drug development as a building block for creating new pharmaceutical compounds. Its structural features can be exploited to design drugs with novel mechanisms of action, potentially leading to the discovery of treatments for previously untreatable conditions or the improvement of existing therapies.
Used in Medicinal Chemistry Research:
As a compound with unique structural elements, 6-Ethoxy-4-hydroxy-quinoline-3-carboxylic acid is used in medicinal chemistry research to explore its potential as a scaffold for new drug candidates. Researchers can modify its structure to investigate the effects on biological activity, selectivity, and pharmacokinetics, which can guide the optimization of drug candidates.
Check Digit Verification of cas no
The CAS Registry Mumber 303121-10-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,3,1,2 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 303121-10:
(8*3)+(7*0)+(6*3)+(5*1)+(4*2)+(3*1)+(2*1)+(1*0)=60
60 % 10 = 0
So 303121-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO4/c1-2-17-7-3-4-10-8(5-7)11(14)9(6-13-10)12(15)16/h3-6H,2H2,1H3,(H,13,14)(H,15,16)
