30771-87-0 Usage
Uses
Used in Organic Synthesis:
[2-(1-adamantylthio)ethyl]amine is used as a building block in organic synthesis for its ability to contribute to the formation of complex organic compounds, leveraging its adamantane structure and thioether functional group.
Used in Pharmaceutical Development:
In the pharmaceutical industry, [2-(1-adamantylthio)ethyl]amine is utilized as a key intermediate in the synthesis of various drugs, capitalizing on its unique structural properties to enhance drug efficacy and target specific biological pathways.
Used in Agrochemical Production:
[2-(1-adamantylthio)ethyl]amine also finds application in the agrochemical sector, where it serves as a component in the creation of pesticides and other agricultural chemicals, potentially improving their performance and selectivity.
Used as a Reagent in Chemical Reactions:
Due to its chemical properties, [2-(1-adamantylthio)ethyl]amine is employed as a reagent in a variety of chemical reactions, facilitating specific transformations and contributing to the synthesis of desired products.
Overall, [2-(1-adamantylthio)ethyl]amine's diverse applications across different industries underscore its importance and potential in the fields of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 30771-87-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,7,7 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 30771-87:
(7*3)+(6*0)+(5*7)+(4*7)+(3*1)+(2*8)+(1*7)=110
110 % 10 = 0
So 30771-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H21NS/c13-1-2-14-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,1-8,13H2
