308386-36-9 Usage
Uses
Used in Organic Synthesis:
4-(PIPERIDIN-4-YLOXY)PYRIDINE DIHYDROCHLORIDE is used as a building block in the synthesis of various organic compounds. Its unique structure allows for the creation of a wide range of chemical entities with diverse properties and applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-(PIPERIDIN-4-YLOXY)PYRIDINE DIHYDROCHLORIDE is used as a key intermediate in the development of new drugs. Its ability to form various chemical entities makes it a valuable asset in the design and synthesis of potential therapeutic agents.
Used in Medicinal Chemistry:
4-(PIPERIDIN-4-YLOXY)PYRIDINE DIHYDROCHLORIDE is employed as a starting material in medicinal chemistry for the exploration of novel bioactive molecules. Its structural features enable the generation of compounds with potential therapeutic effects against various diseases and conditions.
Used in Chemical Research:
In the field of chemical research, 4-(PIPERIDIN-4-YLOXY)PYRIDINE DIHYDROCHLORIDE is utilized as a subject of study to understand its properties, reactivity, and potential applications. Researchers investigate its behavior in various chemical reactions and interactions to gain insights into its capabilities and limitations.
Check Digit Verification of cas no
The CAS Registry Mumber 308386-36-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,8,3,8 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 308386-36:
(8*3)+(7*0)+(6*8)+(5*3)+(4*8)+(3*6)+(2*3)+(1*6)=149
149 % 10 = 9
So 308386-36-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O.2ClH/c1-5-11-6-2-9(1)13-10-3-7-12-8-4-10;;/h1-2,5-6,10,12H,3-4,7-8H2;2*1H
308386-36-9Relevant academic research and scientific papers
Substituted Indole Compounds
-
Page/Page column 52, (2010/09/07)
Substituted indole compounds corresponding to the formula I: In which R8, R9a, R9b, R10, R11, R200, R210, A, D, T, q, s and t have defined meanings, processes for the preparation thereof, pharmaceutical compositions containing such compounds and the use of substituted indole compounds for the treatment or inhibition of pain and other conditions which are at least partly mediated by Bradykinin 1 receptors (B1R).
