312619-47-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-5-phenyl-1,3,4-thiadiazole is used as a pharmaceutical candidate for its interesting biological activities, including antibacterial, antifungal, and anticancer properties. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Amino-5-phenyl-1,3,4-thiadiazole is used as a building block in organic synthesis for the production of various derivatives with different properties and applications. This enables the development of new agrochemicals with improved efficacy and selectivity.
Used in Organic Synthesis:
2-Amino-5-phenyl-1,3,4-thiadiazole is used as a key intermediate in organic synthesis for the production of various derivatives. Its unique structure and functional groups allow for the creation of compounds with a wide range of properties and applications, making it a valuable component in the synthesis of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 312619-47-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,6,1 and 9 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 312619-47:
(8*3)+(7*1)+(6*2)+(5*6)+(4*1)+(3*9)+(2*4)+(1*7)=119
119 % 10 = 9
So 312619-47-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3S.H2O4S/c9-8-11-10-7(12-8)6-4-2-1-3-5-6;1-5(2,3)4/h1-5H,(H2,9,11);(H2,1,2,3,4)