312693-06-4 Usage
Uses
Used in Pharmaceutical Industry:
3-FLUOROBENZYLZINC CHLORIDE is used as a synthetic reagent for the creation of complex organic molecules that are integral to the development of new pharmaceuticals. Its ability to form carbon-carbon and carbon-heteroatom bonds facilitates the synthesis of diverse drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 3-FLUOROBENZYLZINC CHLORIDE is employed as a key intermediate in the synthesis of novel agrochemicals. Its reactivity in various organic reactions allows for the production of compounds with improved pesticidal properties, contributing to more effective crop protection strategies.
Used in Materials Science:
3-FLUOROBENZYLZINC CHLORIDE is utilized as a building block in the synthesis of advanced materials with unique properties. Its involvement in the formation of carbon-heteroatom bonds is particularly beneficial for the development of materials with tailored electronic, optical, or mechanical characteristics, which can be applied in various high-tech industries.
Used in Organic Synthesis:
3-FLUOROBENZYLZINC CHLORIDE is used as a nucleophile in organic synthesis for reactions such as nucleophilic substitutions, additions to carbonyl compounds, and cross-coupling reactions. Its high reactivity and unique structure enable the formation of a wide range of organic compounds, expanding the scope of synthetic chemistry and facilitating the discovery of new chemical entities with potential applications across various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 312693-06-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,6,9 and 3 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 312693-06:
(8*3)+(7*1)+(6*2)+(5*6)+(4*9)+(3*3)+(2*0)+(1*6)=124
124 % 10 = 4
So 312693-06-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F.ClH.Zn/c1-6-3-2-4-7(8)5-6;;/h2-5H,1H2;1H;/q-1;;+2/p-1/rC7H6F.ClZn/c1-6-3-2-4-7(8)5-6;1-2/h2-5H,1H2;/q-1;+1
312693-06-4Relevant academic research and scientific papers
Preparation of Polyfunctional Naphthyridines by Cobalt-Catalyzed Cross-Couplings of Halogenated Naphthyridines with Magnesium and Zinc Organometallics
Greiner, Robert,Ziegler, Dorothée S.,Cibu, Denise,Jakowetz, Andreas C.,Auras, Florian,Bein, Thomas,Knochel, Paul
supporting information, p. 6384 - 6387 (2017/12/08)
CoCl2 (5%) catalyzes cross-couplings of various halogenated naphthyridines with alkyl- and arylmagnesium halides. Also, arylzinc halides undergo smooth cross-couplings with various naphthyridines in the presence of CoCl2·2LiCl (5%) a
A practical cobalt-catalyzed cross-coupling of benzylic zinc reagents with aryl and heteroaryl bromides or chlorides
Benischke, Andreas D.,Knoll, Irina,Rérat, Alice,Gosmini, Corinne,Knochel, Paul
supporting information, p. 3171 - 3174 (2016/02/20)
A catalytic system consisting of 5 mol% CoCl2 and 10 mol% isoquinoline allows a convenient cross-coupling of benzylic zinc reagents with various aryl and heteroaryl bromides or chlorides leading to polyfunctionalized diaryl- and aryl-heteroaryl-methane derivatives.
