31555-05-2 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
Methyl-4-hydroxy-2-butynoate is utilized as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its chemical structure allows for the development of new compounds with potential therapeutic and pesticidal properties, contributing to advancements in healthcare and agriculture.
Used in Food Industry as a Flavoring Agent:
In the food industry, Methyl-4-hydroxy-2-butynoate is employed as a flavoring agent to impart a sweet, fruity taste to a variety of products. Its ability to enhance the flavor profile of food items makes it a valuable ingredient in the creation of innovative and appealing food products.
Used in Fragrance Production:
Methyl-4-hydroxy-2-butynoate is also used in the production of fragrances, capitalizing on its sweet, fruity aroma to create appealing scents for various applications, such as perfumes, cosmetics, and personal care products.
Used as a Solvent in Chemical Reactions:
Due to its chemical properties, Methyl-4-hydroxy-2-butynoate serves as a solvent in various chemical reactions. Its ability to dissolve a wide range of substances makes it a useful component in the synthesis of new compounds and the facilitation of chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 31555-05-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,5,5 and 5 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 31555-05:
(7*3)+(6*1)+(5*5)+(4*5)+(3*5)+(2*0)+(1*5)=92
92 % 10 = 2
So 31555-05-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H6O3/c1-8-5(7)3-2-4-6/h6H,4H2,1H3
