31633-71-3 Usage
Uses
Used in Pharmaceutical Synthesis:
Dimethyl 3-methyl-4-oxopiperidine-1,3-dicarboxylate serves as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows it to be a valuable building block for the development of new drugs, enhancing the therapeutic options available in the medical field.
Used in Organic Compound Production:
dimethyl 3-methyl-4-oxopiperidine-1,3-dicarboxylate is also utilized in the production of other organic compounds, demonstrating its broad applicability in organic chemistry. Its presence as a versatile intermediate aids in the creation of a wide range of chemical products.
Used in Antiviral and Antimicrobial Applications:
Dimethyl 3-methyl-4-oxopiperidine-1,3-dicarboxylate has been studied for its potential biological activities, including antiviral and antimicrobial properties. Its ability to combat viruses and bacteria makes it a promising candidate for use in treatments and preventive measures against infectious diseases.
Used in Chemical Industry:
Its structure and properties render dimethyl 3-methyl-4-oxopiperidine-1,3-dicarboxylate a valuable intermediate in the chemical industry. It plays a crucial role in the synthesis of various chemical products, contributing to the advancement of the industry and the development of new applications.
Check Digit Verification of cas no
The CAS Registry Mumber 31633-71-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,6,3 and 3 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 31633-71:
(7*3)+(6*1)+(5*6)+(4*3)+(3*3)+(2*7)+(1*1)=93
93 % 10 = 3
So 31633-71-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO5/c1-10(8(13)15-2)6-11(9(14)16-3)5-4-7(10)12/h4-6H2,1-3H3
