31748-45-5 Usage
Uses
Used in Organic Synthesis:
3-Cyano-2-methyl-2H-indazole is used as a synthetic building block for the development of various organic compounds. Its unique chemical structure, which includes a cyano group and a methyl group attached to an indazole ring, allows it to participate in a range of chemical reactions, facilitating the synthesis of diverse molecules with potential applications in pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Cyano-2-methyl-2H-indazole is utilized as a key intermediate in the synthesis of novel drug candidates. Its incorporation into drug molecules can potentially enhance their pharmacological properties, such as potency, selectivity, and bioavailability. 3-CYANO-2-METHYL-2H-INDAZOLE's reactivity and structural diversity make it a promising starting point for the design and development of new therapeutic agents.
Used in Agrochemical Industry:
3-Cyano-2-methyl-2H-indazole also finds application in the agrochemical industry, where it is employed in the synthesis of new pesticides, herbicides, and other crop protection agents. Its unique chemical properties enable the creation of molecules with improved efficacy, selectivity, and environmental compatibility, contributing to the development of more sustainable and effective agricultural solutions.
Used in Research and Development:
In addition to its practical applications, 3-Cyano-2-methyl-2H-indazole is also used as a research tool in various scientific studies. Its unique chemical properties make it an interesting subject for exploring new reaction pathways, understanding molecular interactions, and developing innovative synthetic strategies. 3-CYANO-2-METHYL-2H-INDAZOLE's role in research and development is crucial for advancing the knowledge and capabilities of the chemical and life sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 31748-45-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,7,4 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 31748-45:
(7*3)+(6*1)+(5*7)+(4*4)+(3*8)+(2*4)+(1*5)=115
115 % 10 = 5
So 31748-45-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3/c1-12-9(6-10)7-4-2-3-5-8(7)11-12/h2-5H,1H3
