3176-50-9 Usage
Uses
Used in Organic Chemistry:
CAS# 3176-50-9 is used as a reagent in organic chemistry for the synthesis of various compounds, such as esters and ethers. Its unique properties make it a valuable component in the creation of a wide range of chemical products.
Used in Pharmaceutical Production:
In the pharmaceutical industry, CAS# 3176-50-9 is utilized as an intermediate in the production of various medications. Its role in the synthesis process contributes to the development of new and effective drugs.
Used in Agrochemical Production:
Similarly, in the agrochemical sector, CAS# 3176-50-9 is employed as an intermediate for the synthesis of different agrochemicals, which are essential for enhancing crop protection and productivity.
Used as a Solvent:
Due to its solvent properties, CAS# 3176-50-9 is also used in various industrial applications where its ability to dissolve other substances is required, further broadening its utility in chemical processes and formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 3176-50-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,1,7 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3176-50:
(6*3)+(5*1)+(4*7)+(3*6)+(2*5)+(1*0)=79
79 % 10 = 9
So 3176-50-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H3N5S/c4-2-7-8-1-5-6-3(8)9-2/h1H,(H2,4,7)
