3194-70-5 Usage
Uses
Used in Polymer Synthesis Industry:
2-Vinyl-4,6-diamino-1,3,5-triazine is used as a monomer for the synthesis of polymers, particularly in the production of resins and coatings. Its unique chemical structure contributes to the formation of polymers with specific properties, such as durability, resistance, and adhesion.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2-Vinyl-4,6-diamino-1,3,5-triazine is used as a building block in the synthesis of various pharmaceuticals. Its versatile chemical properties allow for the development of new drugs with potential therapeutic applications.
Used in Agricultural Chemical Synthesis:
2-Vinyl-4,6-diamino-1,3,5-triazine is also employed as a building block in the synthesis of agricultural chemicals. Its incorporation into these products can enhance their effectiveness in crop protection and yield improvement.
Used in Specialty Chemical Synthesis:
VDAT is utilized in the synthesis of specialty chemicals for various applications, such as dyes, pigments, and other industrial chemicals. Its unique properties enable the creation of novel compounds with specific characteristics tailored to meet industry needs.
Safety Precautions:
Due to its hazardous nature, 2-Vinyl-4,6-diamino-1,3,5-triazine requires proper safety precautions during handling and storage. This includes the use of appropriate personal protective equipment, ensuring proper ventilation, and following established safety guidelines to minimize potential health and environmental risks.
Check Digit Verification of cas no
The CAS Registry Mumber 3194-70-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,1,9 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3194-70:
(6*3)+(5*1)+(4*9)+(3*4)+(2*7)+(1*0)=85
85 % 10 = 5
So 3194-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N5/c1-2-3-8-4(6)10-5(7)9-3/h2H,1H2,(H4,6,7,8,9,10)
