31982-77-1 Usage
Description
Pentanamide, 2-amino-N-hydroxy-3-methyl-, (S-(R,R))is a compound with the molecular formula C7H15NO2, characterized by its 2-amino-N-hydroxy-3-methylpentanamide structure and a specific stereochemical form denoted by the (S-(R,R))designation. It is an amide derivative that is utilized in the realm of chemical research and development, with its properties and potential applications being the subject of ongoing study.
Uses
Used in Chemical Research and Development:
Pentanamide, 2-amino-N-hydroxy-3-methyl-, (S-(R,R))is employed as a compound in chemical research and development for its unique structure and stereochemistry. Its specific properties and potential applications are under investigation, which may lead to advancements in various fields of chemistry and related industries.
Check Digit Verification of cas no
The CAS Registry Mumber 31982-77-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,9,8 and 2 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 31982-77:
(7*3)+(6*1)+(5*9)+(4*8)+(3*2)+(2*7)+(1*7)=131
131 % 10 = 1
So 31982-77-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H14N2O2/c1-3-4(2)5(7)6(9)8-10/h4-5,10H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1