321309-27-7 Usage
Uses
Used in Pharmaceutical Research:
3,5-DIMETHYL-4-ISOXAZOLYL ISOTHIOCYANATE is used as a research compound for its potential anti-cancer properties. It is being studied for its ability to target and inhibit the growth of cancer cells, making it a promising candidate for the development of new cancer therapies.
Used in Organic Synthesis:
3,5-DIMETHYL-4-ISOXAZOLYL ISOTHIOCYANATE is used as a key intermediate in the synthesis of various organic compounds. Its unique structure and reactivity make it a valuable building block for the creation of new molecules with potential applications in various industries.
Used in Antimicrobial Applications:
3,5-DIMETHYL-4-ISOXAZOLYL ISOTHIOCYANATE is used as an antimicrobial agent due to its ability to inhibit the growth of bacteria and other microorganisms. This property makes it a potential candidate for use in the development of new antimicrobial products, such as disinfectants and sanitizers, to help combat the spread of infectious diseases.
Used in Chemical Research:
3,5-DIMETHYL-4-ISOXAZOLYL ISOTHIOCYANATE is used as a research tool in chemical studies to investigate its reactivity, stability, and potential applications in various chemical processes. Understanding its properties can lead to the discovery of new reactions and the development of innovative synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 321309-27-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,1,3,0 and 9 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 321309-27:
(8*3)+(7*2)+(6*1)+(5*3)+(4*0)+(3*9)+(2*2)+(1*7)=97
97 % 10 = 7
So 321309-27-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2OS/c1-4-6(7-3-10)5(2)9-8-4/h1-2H3
Xn:Harmful;
