32133-36-1 Usage
Description
DL-3,4-Difluorophenylalanine is a synthetic amino acid derivative characterized by the chemical formula C9H10F2NO2. It represents a modified version of the natural amino acid phenylalanine, distinguished by the substitution of two hydrogen atoms on the phenyl ring with fluorine atoms. This alteration endows the compound with unique properties, positioning it as a candidate for various applications in research, medicine, and pharmaceutical development.
Uses
Used in Research and Medicine:
DL-3,4-Difluorophenylalanine is utilized as a research tool for investigating protein structure and function, given its ability to modify the properties of proteins when incorporated into their structure. This makes it valuable for studying the effects of amino acid substitutions on protein behavior.
Used in Protein Engineering:
It serves as a building block in protein engineering, where it can be used to create novel proteins with altered properties, potentially leading to the development of new biocatalysts or therapeutic agents.
Used in Drug Development:
DL-3,4-Difluorophenylalanine is explored as a precursor in the development of fluorinated pharmaceuticals. The presence of fluorine atoms can significantly influence the pharmacokinetics and pharmacodynamics of drug molecules, potentially enhancing their efficacy or stability.
Used in Investigative Studies:
DL-3,4-Difluorophenylalanine is also being investigated for its potential applications in various fields, although its specific uses and effects are still under active research. Further studies are necessary to fully elucidate its potential applications and implications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 32133-36-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,3 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 32133-36:
(7*3)+(6*2)+(5*1)+(4*3)+(3*3)+(2*3)+(1*6)=71
71 % 10 = 1
So 32133-36-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9F2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14)
32133-36-1Relevant articles and documents
ANTIBACTERIALS AND/OR MODULATORS OF BIOFILM FORMATION AND METHODS OF USING THE SAME
-
Paragraph 0094, (2017/04/11)
Amides substituted with aromatic groups were synthesized and some were purified to create enantiomer pure compounds. The compounds were tested to determine their ability to inhibit the growth of bacteria and the formation of biofilms created by bacteria. Some of these compounds were found to be effective antibacterials and to effectively inhibit the formation of biofilms.
