32314-09-3 Usage
Uses
Used in Pharmaceutical Synthesis:
2,3,5-Tribromo-pyrazine is used as a key intermediate in the synthesis of various pharmaceuticals due to its unique reactivity and properties. The presence of bromine atoms allows for a wide range of chemical reactions, facilitating the creation of diverse drug molecules with potential therapeutic applications.
Used in Agrochemical Production:
In the agrochemical industry, 2,3,5-Tribromo-pyrazine serves as a crucial building block for the development of new pesticides and other agrochemicals. Its chemical properties contribute to the design of effective compounds that can protect crops and enhance agricultural productivity.
Used in Organic Chemistry Research:
2,3,5-Tribromo-pyrazine is utilized as a versatile compound in organic chemistry research, enabling scientists to explore its reactivity and properties in various chemical reactions. This research contributes to the advancement of organic chemistry and the discovery of new synthetic pathways and applications.
Used in Drug Discovery:
2,3,5-Tribromo-pyrazine is being investigated for its potential biological activity, making it a promising candidate for drug discovery. Its unique structure and reactivity may lead to the development of new therapeutic agents for various medical conditions, further expanding its applications in the pharmaceutical field.
Check Digit Verification of cas no
The CAS Registry Mumber 32314-09-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,3,1 and 4 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 32314-09:
(7*3)+(6*2)+(5*3)+(4*1)+(3*4)+(2*0)+(1*9)=73
73 % 10 = 3
So 32314-09-3 is a valid CAS Registry Number.
InChI:InChI=1S/C4HBr3N2/c5-2-1-8-3(6)4(7)9-2/h1H
