32314-09-3 Usage
General Description
2,3,5-Tribromo-pyrazine is a chemical compound that consists of a pyrazine ring with three bromine atoms attached at positions 2, 3, and 5. It is commonly used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and other organic compounds. The presence of the bromine atoms imparts unique reactivity and properties to the molecule, making it useful in a wide range of chemical reactions. Additionally, 2,3,5-Tribromo-pyrazine has been studied for its potential biological activity and is being investigated as a potential drug candidate for various medical applications. Its versatile nature and potential applications make it an important compound in the field of organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 32314-09-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,3,1 and 4 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 32314-09:
(7*3)+(6*2)+(5*3)+(4*1)+(3*4)+(2*0)+(1*9)=73
73 % 10 = 3
So 32314-09-3 is a valid CAS Registry Number.
InChI:InChI=1S/C4HBr3N2/c5-2-1-8-3(6)4(7)9-2/h1H
