32388-00-4 Usage
Uses
Used in Organic Synthesis:
2,3-DIMETHYL-6,7-DIMETHOXYQUINOXALINE is used as a synthetic building block for the development of various complex organic molecules. Its unique structure and functional groups make it a versatile component in the synthesis of a wide range of compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,3-DIMETHYL-6,7-DIMETHOXYQUINOXALINE is used as a key intermediate in the synthesis of novel drug candidates. Its incorporation into drug molecules can potentially enhance their pharmacological properties, such as potency, selectivity, and bioavailability, leading to the development of more effective therapeutic agents.
Used in Agrochemical Industry:
2,3-DIMETHYL-6,7-DIMETHOXYQUINOXALINE also finds application in the agrochemical industry, where it is utilized as a starting material for the synthesis of new pesticides, herbicides, and other crop protection agents. Its unique chemical properties can contribute to the development of more effective and environmentally friendly agrochemicals.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 2,3-DIMETHYL-6,7-DIMETHOXYQUINOXALINE is used as a precursor for the synthesis of various dyes and pigments. Its chemical structure can be modified to produce a range of colors and shades, making it a valuable component in the development of new dyes and pigments for various applications, such as textiles, plastics, and printing inks.
Used in Material Science:
2,3-DIMETHYL-6,7-DIMETHOXYQUINOXALINE is also employed in the field of material science, where it can be used to develop new materials with unique properties. Its incorporation into polymers, for example, can lead to the creation of materials with enhanced thermal stability, electrical conductivity, or mechanical strength, depending on the specific application requirements.
Check Digit Verification of cas no
The CAS Registry Mumber 32388-00-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,3,8 and 8 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 32388-00:
(7*3)+(6*2)+(5*3)+(4*8)+(3*8)+(2*0)+(1*0)=104
104 % 10 = 4
So 32388-00-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N2O2/c1-7-8(2)14-10-6-12(16-4)11(15-3)5-9(10)13-7/h5-6H,1-4H3
32388-00-4Relevant academic research and scientific papers
One-pot synthesis of quinoxalines from reductive coupling of 2-nitroanilines and 1,2-diketones using indium
Go, Ahra,Lee, Geunsoo,Kim, Jaeho,Bae, Seolhee,Lee, Byung Min,Kim, Byeong Hyo
, p. 1215 - 1226 (2015/03/04)
The one-pot reduction-cyclization of 2-nitroanilines and 1,2-diketones to give quinoxalines was investigated. Using indium and an appropriate acid such as acetic acid or indium(III) chloride, various quinoxaline derivatives including 2,3-dialkylquinoxalines, 2,3-diphenylquinoxalines, 2,3-di-2-thiophenylquinoxalines, 2,3-di(pyridin-2-yl)quinoxalines, and dibenzo[a,c]phenazines were synthesized in moderate to excellent yield.