3247-70-9 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLOROMETHYL-5-(4-CHLOROPHENYL)-1,3,4-THIADIAZOLE is used as a building block for the development of new drugs due to its unique molecular structure and properties. Its chlorine atoms and thiadiazole ring contribute to its versatility in the synthesis of various biologically active compounds, making it a valuable target for medicinal chemistry research.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-CHLOROMETHYL-5-(4-CHLOROPHENYL)-1,3,4-THIADIAZOLE is utilized as a target compound for exploring its potential applications in drug discovery. Its distinctive molecular features, including the presence of chlorine atoms and the thiadiazole ring, offer opportunities for the design and synthesis of novel therapeutic agents with potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 3247-70-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,4 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3247-70:
(6*3)+(5*2)+(4*4)+(3*7)+(2*7)+(1*0)=79
79 % 10 = 9
So 3247-70-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N2S/c1-3-2-5-4(7)6-3/h2H,1H3,(H2,5,6,7)
