32511-84-5 Usage
Uses
Used in Pharmaceutical Applications:
1-butyl-4-methyl-2(1H)quinoline is used as a pharmaceutical agent for its potential therapeutic properties. Its unique structure may contribute to the development of new drugs or the enhancement of existing ones, depending on its reactivity and interaction with biological systems.
Used in Dye Industry:
1-butyl-4-methyl-2(1H)quinoline is used as a dye due to its aromatic structure, which can impart color to various materials. This application is based on the compound's ability to absorb and reflect light, making it suitable for use in the production of colored products.
Used in Scientific Research:
1-butyl-4-methyl-2(1H)quinoline is used as a reagent in scientific research for its potential role in chemical reactions and experiments. Its unique structural properties may facilitate the study of various chemical processes and contribute to the advancement of scientific knowledge.
Used in Environmental Applications:
1-butyl-4-methyl-2(1H)quinoline may be used in environmental applications, such as in the development of new materials or processes that can help address environmental challenges. 1-butyl-4-methyl-2(1H)quinoline's properties may be harnessed to create innovative solutions that can contribute to a more sustainable future. However, it is crucial to consider the potential environmental impact of this chemical and ensure that its use is managed responsibly.
Check Digit Verification of cas no
The CAS Registry Mumber 32511-84-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,5,1 and 1 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 32511-84:
(7*3)+(6*2)+(5*5)+(4*1)+(3*1)+(2*8)+(1*4)=85
85 % 10 = 5
So 32511-84-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO/c1-3-4-9-15-13-8-6-5-7-12(13)11(2)10-14(15)16/h5-8,10H,3-4,9H2,1-2H3
