32580-00-0 Usage
Uses
Used in Organic Synthesis:
2,4:3,5-Di-O-benzylidene-aldehydo-D-ribose hydrate is used as a reagent in the preparation of various asymmetrical and symmetrical glycerides. Its unique structure allows for the synthesis of a wide range of organic molecules, making it a valuable component in organic chemistry.
Used in Pharmaceutical Research and Development:
2,4:3,5-DI-O-BENZYLIDENE-ALDEHYDO-D-RIBOSE HYDRATE serves as a building block for the synthesis of nucleoside analogs and other bioactive compounds. Its potential antimicrobial and antiparasitic properties make it a promising candidate for the development of new drugs and therapies.
Used in the Synthesis of Bioactive Compounds:
2,4:3,5-Di-O-benzylidene-aldehydo-D-ribose hydrate is used as a key intermediate in the synthesis of various bioactive compounds, including nucleoside analogs. Its unique structure and reactivity make it an essential component in the development of new pharmaceuticals and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 32580-00-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,5,8 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 32580-00:
(7*3)+(6*2)+(5*5)+(4*8)+(3*0)+(2*0)+(1*0)=90
90 % 10 = 0
So 32580-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H18O5.H2O/c20-11-15-17-16(23-19(22-15)14-9-5-2-6-10-14)12-21-18(24-17)13-7-3-1-4-8-13;/h1-11,15-19H,12H2;1H2/t15-,16+,17-,18?,19?;/m0./s1