32580-00-0 Usage
General Description
2,4:3,5-Di-O-benzylidene-aldehydo-D-ribose hydrate is a chemical compound that is used in the synthesis of various organic molecules. It is a hydrate form of 2,4:3,5-Di-O-benzylidene-D-ribose, which is a versatile compound in organic chemistry. This chemical is commonly used as a reagent in the preparation of various asymmetrical and symmetrical glycerides, and it also serves as a building block for the synthesis of nucleoside analogs and other bioactive compounds. Additionally, it is known for its potential antimicrobial and antiparasitic properties, making it a valuable tool in pharmaceutical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 32580-00-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,5,8 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 32580-00:
(7*3)+(6*2)+(5*5)+(4*8)+(3*0)+(2*0)+(1*0)=90
90 % 10 = 0
So 32580-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H18O5.H2O/c20-11-15-17-16(23-19(22-15)14-9-5-2-6-10-14)12-21-18(24-17)13-7-3-1-4-8-13;/h1-11,15-19H,12H2;1H2/t15-,16+,17-,18?,19?;/m0./s1