3265-71-2 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 2-METHYL-4,5,6,7-TETRAFLUOROBENZOFURAN-3-CARBOXYLATE is used as a building block for the synthesis of various pharmaceuticals due to its unique structure and reactivity. It contributes to the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, ETHYL 2-METHYL-4,5,6,7-TETRAFLUOROBENZOFURAN-3-CARBOXYLATE serves as a key intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique structure allows for the creation of effective and targeted agrochemicals.
Used in Academic Research:
ETHYL 2-METHYL-4,5,6,7-TETRAFLUOROBENZOFURAN-3-CARBOXYLATE is utilized as a reagent in organic chemistry reactions, facilitating the synthesis of complex organic compounds and contributing to the advancement of organic chemistry.
Used as a Reference Standard in Analytical Chemistry:
Due to its well-defined structure and properties, ETHYL 2-METHYL-4,5,6,7-TETRAFLUOROBENZOFURAN-3-CARBOXYLATE is employed as a reference standard in analytical chemistry. It helps in the accurate identification and quantification of compounds in various analytical techniques, ensuring the reliability and accuracy of chemical analyses.
Check Digit Verification of cas no
The CAS Registry Mumber 3265-71-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,6 and 5 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 3265-71:
(6*3)+(5*2)+(4*6)+(3*5)+(2*7)+(1*1)=82
82 % 10 = 2
So 3265-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H8F4O3/c1-3-18-12(17)5-4(2)19-11-6(5)7(13)8(14)9(15)10(11)16/h3H2,1-2H3
