3267-76-3

Usage

Uses

Used in Pharmaceutical Industry:
COBALT SUCCINATE is used as a therapeutic agent for treating certain medical conditions, such as anemia and other cobalt deficiency-related disorders. It helps in the production of red blood cells and supports overall health.
Used in Nutritional Supplements:
COBALT SUCCINATE is used as a component in vitamin preparations, particularly in vitamin B12 supplements, to support the body's energy production and maintain healthy nerve function.
Used in Animal Nutrition:
In the animal nutrition industry, COBALT SUCCINATE is used as a dietary supplement for livestock, such as cattle and poultry, to ensure they receive adequate cobalt levels for optimal health and growth.
Used in Chemical Industry:
COBALT SUCCINATE can also be used as a catalyst in various chemical reactions, particularly in the production of certain chemicals and pharmaceuticals, due to its unique chemical properties.

InChI:InChI=1/C4H6O4.Co/c5-3(6)1-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);/q;+2/p-2

Upstream product

• 110-15-6 succinic acid 

Relevant academic research and scientific papers

Kinetics of solid state reactions Co2+, Cu2+ and Zn2+ basic carbonates with some aliphatic acids

The kinetic description and mechanism of the solid-state reactions between metal basic carbonate (M = Co2+, Cu2+ and Zn2+) and aliphatic carboxylic acids (oxalic, tartaric, succinic and citric acids) were studied using non

Synthesis and equilibrium studies of mixed-ligand complexes of Co(II), Ni(II), and Cu(II) with some aliphatic dicarboxylic acids and creatinine

Ternary mixed-ligand metal complexes [M(L1)(L2) 2](H2O)n, where M = Co(II), Ni(II), or Cu(II), L1 = the dianion of succinic, malic, or tartaric acid, and L 2 = creatinine, were synthesized and characterized using microchemical and thermal analyses, molar conductance, infrared, and electronic spectral measurements. A square-planar structure is suggested for the Co(II) and Cu(II) ternary complexes, whereas Ni(II) ternary complexes have tetrahedral stereochemistry. Formation constants of the binary and ternary complexes in such systems were determined by pH-metric titrations at 25 ± 0.1°C and at a constant ionic strength I = 0.1 M (KNO3). The stability of the various complexes was discussed in terms of the nature of both the ligands and metal ions. The thermodynamic functions (ΔH, ΔG, and ΔS°) associated with the complex formation of [Cu(II) + aliphatic acids + creatinine] were also determined and examined.