32890-90-7 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloro-2-fluoro-3-methylbenzoic acid is used as a building block for the synthesis of various drug molecules. Its unique structure allows for the development of new pharmaceutical compounds with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 6-chloro-2-fluoro-3-methylbenzoic acid serves as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its chemical properties contribute to the creation of effective and targeted agrochemical products.
Used in Research and Development:
6-Chloro-2-fluoro-3-methylbenzoic acid is utilized as a reagent and intermediate in the production of other organic compounds. Its presence in various chemical reactions aids researchers in the development of new compounds and materials.
Safety Precautions:
Due to its classification as a hazardous chemical, 6-chloro-2-fluoro-3-methylbenzoic acid should be handled and stored according to proper safety measures to ensure the protection of both individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 32890-90-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,8,9 and 0 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 32890-90:
(7*3)+(6*2)+(5*8)+(4*9)+(3*0)+(2*9)+(1*0)=127
127 % 10 = 7
So 32890-90-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3H,1H3,(H,11,12)
