286474-61-1 Usage
Uses
Used in Pharmaceutical Drug Synthesis:
6-Chloro-2-fluoro-3-methylbenzamide is utilized as a key intermediate in the synthesis of pharmaceutical drugs. Its unique structure allows for the development of new compounds with enhanced biological activity and therapeutic potential. It plays a crucial role in the creation of novel drugs for the treatment of various diseases and conditions.
Used in Agrochemical Synthesis:
In the agrochemical industry, 6-chloro-2-fluoro-3-methylbenzamide serves as an essential building block for the synthesis of various agrochemicals. Its incorporation into these compounds can lead to the development of more effective and targeted pesticides, herbicides, and other agricultural chemicals, ultimately contributing to improved crop protection and yield.
Used in Medicinal Chemistry Research:
6-Chloro-2-fluoro-3-methylbenzamide also holds promise in medicinal chemistry research as a valuable building block for the development of new compounds with biological activity. Researchers can use 6-CHLORO-2-FLUORO-3-METHYLBENZAMIDE to explore its potential interactions with biological targets, such as enzymes, receptors, or other proteins, leading to the discovery of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 286474-61-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,8,6,4,7 and 4 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 286474-61:
(8*2)+(7*8)+(6*6)+(5*4)+(4*7)+(3*4)+(2*6)+(1*1)=181
181 % 10 = 1
So 286474-61-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClFNO/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3H,1H3,(H2,11,12)
286474-61-1Relevant academic research and scientific papers
PHENYLACETIC ACID DERIVATIVES
-
Page/Page column 23-24, (2008/06/13)
Compounds of formula (I) pharmaceutically acceptable salts thereof; and pharmaceutically acceptable esters thereof; which are useful for the treatment of COX-2 dependent disorders.
