32954-06-6 Usage
Chemical compound
3-Isoxazolecarboxamide, N-(aminoiminomethyl)-5-methyl-
Derivative of
Isoxazolecarboxamide
Functional groups
Methyl group and aminoiminomethyl group
Nature
Synthetic, not naturally occurring
Biological activity
Likely due to the presence of an amino group
Potential applications
Pharmaceutical or chemical industries
Documentation
Properties and uses not well-documented
Further research
Needed to determine specific properties and potential uses
Check Digit Verification of cas no
The CAS Registry Mumber 32954-06-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,9,5 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 32954-06:
(7*3)+(6*2)+(5*9)+(4*5)+(3*4)+(2*0)+(1*6)=116
116 % 10 = 6
So 32954-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N4O2/c1-3-2-4(10-12-3)5(11)9-6(7)8/h2H,1H3,(H4,7,8,9,11)
32954-06-6Relevant articles and documents
Isoxazole derivatives
-
, (2008/06/13)
Isoxazole derivatives represented by the formula: STR1 are prepared; wherein R1 and R2 each is hydrogen atom, alkyl group of 1 to 8 carbon atoms, or cycloalkyl group of 3 to 10 carbon atoms; R3 and R4 each is hydrogen atom, alkyl group of 1 to 8 carbon atoms, cycloalkyl group of 3 to 10 carbon atoms, or phenyl group; or the group Is morpholino group; and Y is oxo group, thioxo group or imino group; being useful as a hypoglycemic and/or a blood free-fatty-acid normalizing antidiabetic agent.
