32997-15-2 Usage
Uses
Used in Pharmaceutical Industry:
4-(o-Chlorobenzylidene)-2-methyloxazol-5(4H)-one is used as a pharmaceutical compound for its demonstrated anti-inflammatory properties, which can be harnessed to develop treatments for various inflammatory conditions. Its antimicrobial activity also suggests potential applications in the development of new antibiotics or antimicrobial agents to combat resistant strains of bacteria.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-(o-Chlorobenzylidene)-2-methyloxazol-5(4H)-one serves as a valuable target for synthesis and study. Researchers can explore its chemical and physical properties to understand its mechanisms of action and optimize its therapeutic potential, potentially leading to the discovery of novel drugs with improved efficacy and safety profiles.
Used in Drug Synthesis:
4-(o-Chlorobenzylidene)-2-methyloxazol-5(4H)-one's unique structure and biological activities make it a candidate for drug synthesis, where it can be further modified or combined with other molecules to create new pharmaceutical agents with specific therapeutic targets and improved pharmacological properties.
Used in Laboratory Studies:
4-(o-Chlorobenzylidene)-2-methyloxazol-5(4H)-one is utilized in laboratory settings for the investigation of its biological activities and potential applications. Researchers can study its interactions with biological systems, such as cell lines or animal models, to gain insights into its therapeutic potential and mechanisms of action, ultimately contributing to the advancement of medical knowledge and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 32997-15-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,9,9 and 7 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 32997-15:
(7*3)+(6*2)+(5*9)+(4*9)+(3*7)+(2*1)+(1*5)=142
142 % 10 = 2
So 32997-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H8ClNO2/c1-7-13-10(11(14)15-7)6-8-4-2-3-5-9(8)12/h2-6H,1H3/b10-6-
