3304-70-9 Usage
Description
Dimethyl 4,5-imidazoledicarboxylate, also known as Dimethyl 1H-Imidazole-4,5-dicarboxylate, is an organic compound that serves as a crucial intermediate in the synthesis of various pharmaceutical agents. It is characterized by its imidazole ring structure and two esterified carboxylate groups, which contribute to its reactivity and potential applications in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
Dimethyl 4,5-imidazoledicarboxylate is used as an intermediate for the preparation of hedgehog signaling pathway inhibitors, which are antitumor agents. These inhibitors play a significant role in the development of cancer treatments, as they target a key signaling pathway involved in the regulation of cell growth and differentiation.
Additionally, Dimethyl 4,5-imidazoledicarboxylate is used in the synthesis of imidazo[4,5-e][1,3]diazepine-4,8-diones, which exhibit anti-hepatitis B and C virus activities in vitro. This application highlights its potential in the development of antiviral medications, specifically for the treatment of hepatitis B and C infections.
Check Digit Verification of cas no
The CAS Registry Mumber 3304-70-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,0 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3304-70:
(6*3)+(5*3)+(4*0)+(3*4)+(2*7)+(1*0)=59
59 % 10 = 9
So 3304-70-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O4/c1-12-6(10)4-5(7(11)13-2)9-3-8-4/h3H,1-2H3,(H,8,9)