3304-70-9 Usage
Uses
Used in Pharmaceutical Industry:
Dimethyl 4,5-imidazoledicarboxylate is used as an intermediate for the preparation of hedgehog signaling pathway inhibitors, which are antitumor agents. These inhibitors play a significant role in the development of cancer treatments, as they target a key signaling pathway involved in the regulation of cell growth and differentiation.
Additionally, Dimethyl 4,5-imidazoledicarboxylate is used in the synthesis of imidazo[4,5-e][1,3]diazepine-4,8-diones, which exhibit anti-hepatitis B and C virus activities in vitro. This application highlights its potential in the development of antiviral medications, specifically for the treatment of hepatitis B and C infections.
Check Digit Verification of cas no
The CAS Registry Mumber 3304-70-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,3,0 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3304-70:
(6*3)+(5*3)+(4*0)+(3*4)+(2*7)+(1*0)=59
59 % 10 = 9
So 3304-70-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O4/c1-12-6(10)4-5(7(11)13-2)9-3-8-4/h3H,1-2H3,(H,8,9)
