332883-10-0 Usage
Uses
Given the limited information available on 5,6,7,8-Tetrahydro-1,8-naphthyridine-2-methanamine, it is challenging to list specific applications. However, based on its chemical structure and the fact that it is an organic compound, it can be inferred that it may have potential uses in the following areas:
Used in Pharmaceutical Research:
5,6,7,8-Tetrahydro-1,8-naphthyridine-2-methanamine is used as a research compound for exploring its potential pharmaceutical applications. Its unique structure may offer opportunities for the development of new drugs or drug candidates, particularly in the area of medicinal chemistry.
Used in Chemical Synthesis:
In the field of organic chemistry, 5,6,7,8-Tetrahydro-1,8-naphthyridine-2-methanamine may be used as a building block or intermediate in the synthesis of more complex molecules. Its heterocyclic nature and the presence of a methanamine group could make it a valuable component in the creation of novel chemical entities.
Used in Material Science:
5,6,7,8-Tetrahydro-1,8-naphthyridine-2-methanamine could potentially be used in the development of new materials with unique properties. Its chemical structure may contribute to the formation of novel polymers, coatings, or other materials with specific characteristics, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 332883-10-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,2,8,8 and 3 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 332883-10:
(8*3)+(7*3)+(6*2)+(5*8)+(4*8)+(3*3)+(2*1)+(1*0)=140
140 % 10 = 0
So 332883-10-0 is a valid CAS Registry Number.
InChI:InChI=1S/C9H13N3/c10-6-8-4-3-7-2-1-5-11-9(7)12-8/h3-4H,1-2,5-6,10H2,(H,11,12)
