33507-82-3 Usage
General Description
The chemical compound (R,R)-(+)-1,4-DIMETHOXY-2,3-BUTANEDIOL, also known as DIMBOA, is a type of alcohol with two methoxy groups attached to a butanediol molecule. It is classified as a natural product and is found in various plant species such as maize and wheat. DIMBOA is known for its insecticidal properties and is produced by plants as a defense mechanism against herbivorous insects. It is also used in organic chemistry as a chiral building block for the synthesis of various pharmaceuticals and other biologically active compounds. Additionally, it has potential applications in the field of material science and polymer chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 33507-82-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,5,0 and 7 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 33507-82:
(7*3)+(6*3)+(5*5)+(4*0)+(3*7)+(2*8)+(1*2)=103
103 % 10 = 3
So 33507-82-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H14O4/c1-9-3-5(7)6(8)4-10-2/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1