33507-82-3 Usage
Uses
Used in Agriculture:
(R,R)-(+)-1,4-DIMETHOXY-2,3-BUTANEDIOL is used as a natural insecticide for protecting plants like maize and wheat from herbivorous insects. Its insecticidal properties help in reducing crop damage and increasing agricultural yield.
Used in Organic Chemistry:
(R,R)-(+)-1,4-DIMETHOXY-2,3-BUTANEDIOL is used as a chiral building block for the synthesis of various pharmaceuticals and biologically active compounds. Its unique structure allows for the creation of enantiomerically pure molecules, which are essential in the development of effective drugs with minimal side effects.
Used in Material Science and Polymer Chemistry:
(R,R)-(+)-1,4-DIMETHOXY-2,3-BUTANEDIOL is used as a key component in the development of new materials and polymers. Its potential applications in this field are still being explored, but its unique properties make it a promising candidate for creating innovative materials with specific characteristics and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 33507-82-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,5,0 and 7 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 33507-82:
(7*3)+(6*3)+(5*5)+(4*0)+(3*7)+(2*8)+(1*2)=103
103 % 10 = 3
So 33507-82-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H14O4/c1-9-3-5(7)6(8)4-10-2/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1
