336115-72-1 Usage
General Description
"N-[1-(3-Benzyl-7-chloro-4-oxo-3,4-dihydro-quinazolin-2-yl)-propyl]-4-bromo-N-(3-dimethylamino-propyl)-benzamide" is a complex chemical compound with a molecular structure consisting of multiple functional groups, including benzyl, chloro, oxo, quinazolin-2-yl, propyl, bromo, dimethylamino, and benzamide. N-[1-(3-Benzyl-7-chloro-4-oxo-3,4-dihydro-quinazolin-2-yl)-propyl]-4-bromo-N-(3-dimethylamino-propyl)-benzamide is likely to possess various pharmacological properties due to the presence of these functional groups, including potential antipsychotic, anticonvulsant, or antihypertensive effects. The specific biological activity and potential therapeutic use of this compound would require further research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 336115-72-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,6,1,1 and 5 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 336115-72:
(8*3)+(7*3)+(6*6)+(5*1)+(4*1)+(3*5)+(2*7)+(1*2)=121
121 % 10 = 1
So 336115-72-1 is a valid CAS Registry Number.
InChI:InChI=1/C30H32BrClN4O2/c1-4-27(35(18-8-17-34(2)3)29(37)22-11-13-23(31)14-12-22)28-33-26-19-24(32)15-16-25(26)30(38)36(28)20-21-9-6-5-7-10-21/h5-7,9-16,19,27H,4,8,17-18,20H2,1-3H3