337463-88-4 Usage
General Description
6-BROMO-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE is a chemical compound with the molecular formula C5H3BrN2O2. It is a heterocyclic compound that contains a pyridine ring fused to an oxazine ring. 6-BROMO-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE is used in the synthesis of various pharmaceuticals and agrochemicals, and it also has potential biological activities. Additionally, it serves as a valuable building block for the development of new chemical entities. Its unique structural properties make it a valuable target for research and development in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 337463-88-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,3,7,4,6 and 3 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 337463-88:
(8*3)+(7*3)+(6*7)+(5*4)+(4*6)+(3*3)+(2*8)+(1*8)=164
164 % 10 = 4
So 337463-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BrN2O2/c8-5-2-1-4-7(9-5)10-6(11)3-12-4/h1-2H,3H2,(H,9,10,11)